loading...| Preferred Name |
5-hydroxyhexanoic acid |
| Synonyms |
5-hydroxy-hexanoic acid 5-OH-caproic acid 5-hydroxycaproic acid 5-hydroxyhexanoic acid 5-hydroxy caproic acid |
| Definitions |
A medium-chain fatty acid that is hexanoic acid substituted at position 5 by a hydroxy group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_131434 |
| charge |
0 |
| database_cross_reference |
HMDB:HMDB0000525 PMID:575058 Reaxys:1749065 Chemspider:149280 CAS:44843-89-2 PMID:6897376 PMID:640132 LIPID_MAPS_instance:LMFA01050014 |
| definition |
A medium-chain fatty acid that is hexanoic acid substituted at position 5 by a hydroxy group. |
| formula |
C6H12O3 |
| has functional parent | |
| has role | |
| has_exact_synonym |
5-hydroxyhexanoic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
5-hydroxy-hexanoic acid 5-OH-caproic acid 5-hydroxycaproic acid 5-hydroxy caproic acid |
| id |
CHEBI:131434 |
| in_subset | |
| inchi |
InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9) |
| inchikey |
YDCRNMJQROAWFT-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
5-hydroxyhexanoic acid |
| mass |
132.158 |
| monoisotopicmass |
132.07864 |
| notation |
CHEBI:131434 |
| prefLabel |
5-hydroxyhexanoic acid |
| smiles |
OC(CCCC(=O)O)C |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C016502 | Medical Subject Headings / 医学主题词表 | LOOM |