loading...| Preferred Name |
5-chlorosalicylic acid |
| Synonyms |
2-Hydroxy-5-chlorobenzoic acid 5 CSA 5-chloro-2-hydroxybenzoic acid 5-Chloro-2-hydroxybenzoic acid |
| Definitions |
A monohydroxybenzoic acid that is 2-hydroxybenzoic acid (salicylic acid) in which the hydrogen at position 5 is replaced by chlorine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_420128 |
| charge |
0 |
| database_cross_reference |
Reaxys:2046665 PMID:22365879 PMID:21689976 PMID:28166217 AGR:IND43635496 PMID:18819808 PMID:1650428 Patent:CN101684061 CAS:321-14-2 PMID:20062845 Gmelin:561203 Beilstein:2046665 PMID:1944396 PMID:22476141 |
| definition |
A monohydroxybenzoic acid that is 2-hydroxybenzoic acid (salicylic acid) in which the hydrogen at position 5 is replaced by chlorine. |
| formula |
C7H5ClO3 |
| has functional parent | |
| has_exact_synonym |
5-chloro-2-hydroxybenzoic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-Hydroxy-5-chlorobenzoic acid 5 CSA 5-Chloro-2-hydroxybenzoic acid |
| id |
CHEBI:420128 |
| in_subset | |
| inchi |
InChI=1S/C7H5ClO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11) |
| inchikey |
NKBASRXWGAGQDP-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
5-chlorosalicylic acid |
| mass |
172.56600 |
| monoisotopicmass |
171.99272 |
| notation |
CHEBI:420128 |
| prefLabel |
5-chlorosalicylic acid |
| smiles |
OC(=O)c1cc(Cl)ccc1O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_23134 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23134 |