loading...| Preferred Name |
caerulomycin C |
| Synonyms |
(E)-1-(3,4-dimethoxy-2,2'-bipyridin-6-yl)-N-hydroxymethanimine |
| Definitions |
A pyridine alkaloid that is 2,2'-bipyridine substituted by methoxy groups at positions 3 and 4 and a (E)-(hydroxyimino)methyl group at position 6. Isolated from the marine-derived actinomycete Actinoalloteichus cyanogriseus, it exhibits antineoplastic activity. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_69232 |
| charge |
0 |
| database_cross_reference |
PMID:21770434 Chemspider:26618626 Reaxys:7485593 |
| definition |
A pyridine alkaloid that is 2,2'-bipyridine substituted by methoxy groups at positions 3 and 4 and a (E)-(hydroxyimino)methyl group at position 6. Isolated from the marine-derived actinomycete Actinoalloteichus cyanogriseus, it exhibits antineoplastic activity. |
| formula |
C13H13N3O3 |
| has parent hydride | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
| has_exact_synonym |
(E)-1-(3,4-dimethoxy-2,2'-bipyridin-6-yl)-N-hydroxymethanimine |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:69232 |
| in_subset | |
| inchi |
InChI=1S/C13H13N3O3/c1-18-11-7-9(8-15-17)16-12(13(11)19-2)10-5-3-4-6-14-10/h3-8,17H,1-2H3/b15-8+ |
| inchikey |
WZBOHQZLZFLYKP-OVCLIPMQSA-N |
| label |
caerulomycin C |
| mass |
259.26060 |
| monoisotopicmass |
259.09569 |
| notation |
CHEBI:69232 |
| prefLabel |
caerulomycin C |
| smiles |
COc1cc(C=N\O)nc(-c2ccccn2)c1OC |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_26416 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_26416 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C466842 | Medical Subject Headings / 医学主题词表 | LOOM |