| Preferred Name |
glycine zwitterion |
| Synonyms |
glycine 2-azaniumylacetate |
| Definitions |
An amino acid zwitterion arising from transfer of a proton from the carboxy to the amino group of glycine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_57305 |
| charge |
0 |
| database_cross_reference |
Gmelin:1807 MetaCyc:GLY |
| definition |
An amino acid zwitterion arising from transfer of a proton from the carboxy to the amino group of glycine. |
| formula |
C2H5NO2 |
| has_exact_synonym |
2-azaniumylacetate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
glycine |
| id |
CHEBI:57305 |
| in_subset | |
| inchi |
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
| inchikey |
DHMQDGOQFOQNFH-UHFFFAOYSA-N |
| is tautomer of | |
| label |
glycine zwitterion |
| mass |
75.06660 |
| monoisotopicmass |
75.03203 |
| notation |
CHEBI:57305 |
| prefLabel |
glycine zwitterion |
| smiles |
[NH3+]CC([O-])=O |
| treeView | |
| subClassOf |