loading...| Preferred Name |
tirapazamine |
| Synonyms |
tirapazamine 3-Amino-1,2,4-benzotriazine 1,4-dioxide SR 4233 SR-4233 1,2,4-benzotriazin-3-amine 1,4-dioxide |
| Definitions |
A member of the class of benzotriazines that is 1,2,4-benzotriazine carrying an amino substituent at position 3 and two oxido substituents at positions 1 and 4. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_78887 |
| charge |
0 |
| database_cross_reference |
PMID:22331808 Wikipedia:Tirapazamine PMID:23888874 PMID:22531857 CAS:27314-97-2 PMID:24395863 PMID:7954337 PMID:24362462 KEGG:D06167 Reaxys:179322 PMID:24529061 PMID:23033890 PMID:22946564 PMID:22666522 Beilstein:179322 |
| definition |
A member of the class of benzotriazines that is 1,2,4-benzotriazine carrying an amino substituent at position 3 and two oxido substituents at positions 1 and 4. |
| formula |
C7H6N4O2 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_33282 |
| has_exact_synonym |
1,2,4-benzotriazin-3-amine 1,4-dioxide |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
tirapazamine 3-Amino-1,2,4-benzotriazine 1,4-dioxide SR 4233 SR-4233 |
| id |
CHEBI:78887 |
| in_subset | |
| inchi |
InChI=1S/C7H6N4O2/c8-7-9-11(13)6-4-2-1-3-5(6)10(7)12/h1-4H,(H2,8,9) |
| inchikey |
ORYDPOVDJJZGHQ-UHFFFAOYSA-N |
| label |
tirapazamine |
| mass |
178.14810 |
| monoisotopicmass |
178.04908 |
| notation |
CHEBI:78887 |
| prefLabel |
tirapazamine |
| smiles |
Nc1n[n+]([O-])c2ccccc2[n+]1[O-] |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35580 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35580 |