loading...| Preferred Name |
N-(indole-3-acetyl)glutamic acid |
| Synonyms |
(indole-3-acetyl)glutamic acid N-(indol-3-ylacetyl)glutamic acid |
| Definitions |
An indoleacetic acid amide conjugate obtained by formal condensation of the carboxy group of indole-3-acetic acid with the amino group of glutamic acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_136547 |
| charge |
0 |
| database_cross_reference |
Reaxys:443565 |
| definition |
An indoleacetic acid amide conjugate obtained by formal condensation of the carboxy group of indole-3-acetic acid with the amino group of glutamic acid. |
| formula |
C15H16N2O5 |
| has functional parent | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(indole-3-acetyl)glutamic acid N-(indol-3-ylacetyl)glutamic acid |
| id |
CHEBI:136547 |
| in_subset | |
| inchi |
InChI=1S/C15H16N2O5/c18-13(17-12(15(21)22)5-6-14(19)20)7-9-8-16-11-4-2-1-3-10(9)11/h1-4,8,12,16H,5-7H2,(H,17,18)(H,19,20)(H,21,22) |
| inchikey |
YRKLGWOHYXIKSF-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
N-(indole-3-acetyl)glutamic acid |
| mass |
304.299 |
| monoisotopicmass |
304.10592 |
| notation |
CHEBI:136547 |
| prefLabel |
N-(indole-3-acetyl)glutamic acid |
| smiles |
O=C(O)C(NC(CC1=CNC2=CC=CC=C12)=O)CCC(=O)O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||