loading...| Preferred Name |
decalin |
| Synonyms |
bicyclo[4.4.0]decane decahydronaphthalene Dekahydronaphthalin Decahydronaphthalin naphthane decalin Naphthan Dekalin perhydronaphthalene |
| Definitions |
An ortho-fused bicyclic hydrocarbon that is the decahydro- derivative of naphthalene. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_38853 |
| charge |
0 |
| database_cross_reference |
Reaxys:878165 Gmelin:185147 PMID:23263676 Beilstein:878165 PMID:24689596 Wikipedia:Decalin PMID:23510204 CAS:91-17-8 |
| definition |
An ortho-fused bicyclic hydrocarbon that is the decahydro- derivative of naphthalene. |
| formula |
C10H18 |
| has role | |
| has_exact_synonym |
decahydronaphthalene decalin |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
bicyclo[4.4.0]decane Dekahydronaphthalin Decahydronaphthalin naphthane Naphthan Dekalin perhydronaphthalene |
| id |
CHEBI:38853 |
| in_subset | |
| inchi |
InChI=1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2 |
| inchikey |
NNBZCPXTIHJBJL-UHFFFAOYSA-N |
| label |
decalin |
| mass |
138.24992 |
| monoisotopicmass |
138.14085 |
| notation |
CHEBI:38853 |
| prefLabel |
decalin |
| smiles |
C1CCC2CCCCC2C1 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C007229 | Medical Subject Headings / 医学主题词表 | LOOM |