loading...| Preferred Name |
beta-aminoarteether |
| Synonyms |
2-(10beta-dihydroartemisinoxy)ethylamine 2-{[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.0(4,13).0(8,13)]hexadec-10-yl]oxy}ethanamine beta-2'-aminoarteether 2-[[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl]oxy]ethanamine 10-(beta-aminoethoxy)dihydroartemisinin |
| Definitions |
An artemisinin derivative in which the lactone of (+)-artemisinin has been converted into the corresponding lactol 2-aminoethyl ether [beta (S) configuration at the new stereocentre]. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_78567 |
| charge |
0 |
| database_cross_reference |
PMID:23459298 Reaxys:7378418 |
| definition |
An artemisinin derivative in which the lactone of (+)-artemisinin has been converted into the corresponding lactol 2-aminoethyl ether [beta (S) configuration at the new stereocentre]. |
| formula |
C17H29NO5 |
| has_exact_synonym |
2-{[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.0(4,13).0(8,13)]hexadec-10-yl]oxy}ethanamine 2-[[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl]oxy]ethanamine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-(10beta-dihydroartemisinoxy)ethylamine beta-2'-aminoarteether 10-(beta-aminoethoxy)dihydroartemisinin |
| id |
CHEBI:78567 |
| in_subset | |
| inchi |
InChI=1S/C17H29NO5/c1-10-4-5-13-11(2)14(19-9-8-18)20-15-17(13)12(10)6-7-16(3,21-15)22-23-17/h10-15H,4-9,18H2,1-3H3/t10-,11-,12+,13+,14+,15-,16-,17-/m1/s1 |
| inchikey |
HPGHCIXRRLNXRN-XQLAAWPRSA-N |
| label |
beta-aminoarteether |
| mass |
327.41590 |
| monoisotopicmass |
327.20457 |
| notation |
CHEBI:78567 |
| prefLabel |
beta-aminoarteether |
| smiles |
C[C@@H]1CC[C@H]2[C@@H](C)[C@@H](OCCN)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||