loading...| Preferred Name |
zinolol |
| Synonyms |
2-(O-beta-D-glucopyranosyl)-6-(N-methylaminomethyl)-1,4-dihydroxybenzene 2,5-dihydroxy-3-[(methylamino)methyl]phenyl beta-D-glucopyranoside |
| Definitions |
A monosaccharide derivative that is 1,4-dihydroxybenzene substituted by a (methylamino)methyl group at position 6 and a beta-D-glucopyranosyloxy residue at position 2. Isolated from Anagallis monelli, it exhibits antimutagenic and antioxidant activities. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_66506 |
| charge |
0 |
| database_cross_reference |
PMID:17329877 Reaxys:11028017 |
| definition |
A monosaccharide derivative that is 1,4-dihydroxybenzene substituted by a (methylamino)methyl group at position 6 and a beta-D-glucopyranosyloxy residue at position 2. Isolated from Anagallis monelli, it exhibits antimutagenic and antioxidant activities. |
| formula |
C14H21NO8 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_22586 |
| has_exact_synonym |
2,5-dihydroxy-3-[(methylamino)methyl]phenyl beta-D-glucopyranoside |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-(O-beta-D-glucopyranosyl)-6-(N-methylaminomethyl)-1,4-dihydroxybenzene |
| id |
CHEBI:66506 |
| in_subset | |
| inchi |
InChI=1S/C14H21NO8/c1-15-4-6-2-7(17)3-8(10(6)18)22-14-13(21)12(20)11(19)9(5-16)23-14/h2-3,9,11-21H,4-5H2,1H3/t9-,11-,12+,13-,14-/m1/s1 |
| inchikey |
XDRANPRXTFIDRB-RGCYKPLRSA-N |
| label |
zinolol |
| mass |
331.31840 |
| monoisotopicmass |
331.12672 |
| notation |
CHEBI:66506 |
| prefLabel |
zinolol |
| smiles |
CNCc1cc(O)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_63367 http://purl.obolibrary.org/obo/CHEBI_50995 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_63367 http://purl.obolibrary.org/obo/CHEBI_50995 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C520692 | Medical Subject Headings / 医学主题词表 | LOOM |