loading...| Preferred Name |
felodipine |
| Synonyms |
3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate (+-)-ethyl methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate FELODIPINE felodipine felodipinum 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate felodipina |
| Definitions |
The mixed (methyl, ethyl) diester of 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid. A calcium-channel blocker, it lowers blood pressure by reducing peripheral vascular resistance through a highly selective action on smooth muscle in arteriolar resistance vessels. It is used in the management of hypertension and angina pectoris. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_585948 |
| charge |
0 |
| database_cross_reference |
Reaxys:4331472 Wikipedia:Felodipine PMID:18457386 CAS:72509-76-3 DrugBank:DB01023 PDBeChem:225 Patent:EP7293 LINCS:LSM-1447 KEGG:D00319 Patent:US4264611 Drug_Central:1142 |
| definition |
The mixed (methyl, ethyl) diester of 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid. A calcium-channel blocker, it lowers blood pressure by reducing peripheral vascular resistance through a highly selective action on smooth muscle in arteriolar resistance vessels. It is used in the management of hypertension and angina pectoris. |
| formula |
C18H19Cl2NO4 |
| has_alternative_id |
CHEBI:49383 CHEBI:4996 |
| has_exact_synonym |
FELODIPINE ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate (+-)-ethyl methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate felodipine felodipinum 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester felodipina |
| id |
CHEBI:585948 |
| in_subset | |
| inchi |
InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
| inchikey |
RZTAMFZIAATZDJ-UHFFFAOYSA-N |
| label |
felodipine |
| mass |
384.25400 |
| monoisotopicmass |
383.06911 |
| notation |
CHEBI:585948 |
| prefLabel |
felodipine |
| smiles |
CCOC(=O)C1=C(C)NC(C)=C(C1c1cccc(Cl)c1Cl)C(=O)OC |
| subClassOf |