loading...| Preferred Name |
1-(5-O-phosphono-beta-D-ribofuranosyl)-5-(sulfanylcarbonyl)pyridinium-3-carbonyl adenylate |
| Synonyms |
PCTMN-adenylate |
| Definitions |
An acyclic mixed acid anhydride obtained by condensation of one of the carboxy group of pyridinium-3-sulfanylcarbonyl-5-carboxylic acid mononucleotide with the phosphste group of AMP. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_137397 |
| charge |
+1 |
| database_cross_reference |
PMID:27114550 |
| definition |
An acyclic mixed acid anhydride obtained by condensation of one of the carboxy group of pyridinium-3-sulfanylcarbonyl-5-carboxylic acid mononucleotide with the phosphste group of AMP. |
| formula |
C22H27N6O16P2S |
| has functional parent | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
PCTMN-adenylate |
| id |
CHEBI:137397 |
| in_subset | |
| inchi |
InChI=1S/C22H26N6O16P2S/c23-17-12-18(25-6-24-17)28(7-26-12)20-16(32)14(30)11(43-20)5-41-46(38,39)44-21(33)8-1-9(22(34)47)3-27(2-8)19-15(31)13(29)10(42-19)4-40-45(35,36)37/h1-3,6-7,10-11,13-16,19-20,29-32H,4-5H2,(H5-,23,24,25,34,35,36,37,38,39,47)/p+1/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| inchikey |
BXFOCKPGPXKYAL-HISDBWNOSA-O |
| is conjugate acid of | |
| label |
1-(5-O-phosphono-beta-D-ribofuranosyl)-5-(sulfanylcarbonyl)pyridinium-3-carbonyl adenylate |
| mass |
725.495 |
| monoisotopicmass |
725.06740 |
| notation |
CHEBI:137397 |
| prefLabel |
1-(5-O-phosphono-beta-D-ribofuranosyl)-5-(sulfanylcarbonyl)pyridinium-3-carbonyl adenylate |
| smiles |
O(C[C@H]1O[C@@H]([N+]2=CC(=CC(=C2)C(S)=O)C(=O)OP(OC[C@H]3O[C@@H](N4C=5N=CN=C(N)C5N=C4)[C@@H]([C@@H]3O)O)(=O)O)[C@@H]([C@@H]1O)O)P(O)(=O)O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_37787 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37787 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||