loading...| Preferred Name |
12alpha-hydroxy-3-oxochola-4,6-dien-24-oate |
| Synonyms |
12alpha-hydroxy-3-oxochola-4,6-dien-24-oate |
| Definitions |
Conjugate base of 12alpha-hydroxy-3-oxochola-4,6-dien-24-oic acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_58804 |
| charge |
-1 |
| definition |
Conjugate base of 12alpha-hydroxy-3-oxochola-4,6-dien-24-oic acid. |
| formula |
C24H33O4 |
| has_exact_synonym |
12alpha-hydroxy-3-oxochola-4,6-dien-24-oate |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:58804 |
| in_subset | |
| inchi |
InChI=1S/C24H34O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h5-6,12,14,17-21,26H,4,7-11,13H2,1-3H3,(H,27,28)/p-1/t14-,17+,18-,19+,20+,21+,23+,24-/m1/s1 |
| inchikey |
DJVAMCYXFUWMLS-QUPGBHKMSA-M |
| is conjugate base of | |
| label |
12alpha-hydroxy-3-oxochola-4,6-dien-24-oate |
| mass |
385.51640 |
| monoisotopicmass |
385.23843 |
| notation |
CHEBI:58804 |
| prefLabel |
12alpha-hydroxy-3-oxochola-4,6-dien-24-oate |
| smiles |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])C=CC4=CC(=O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCC([O-])=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||