loading...| Preferred Name |
cyclic AMP-AMP-GMP(3-) |
| Synonyms |
cyclic A(3'-5')pA(3'-5')pG(3'-5')p(3-) 3',3',3'-cAAG 3',3',3'-cAAGMP(3-) |
| Definitions |
A cyclic trinucleotide that consists of two AMP and one GMP units cyclised via 3',5'-linkages, major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_143810 |
| charge |
-3 |
| database_cross_reference |
PMID:30787435 |
| definition |
A cyclic trinucleotide that consists of two AMP and one GMP units cyclised via 3',5'-linkages, major species at pH 7.3. |
| formula |
C30H33N15O19P3 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
cyclic A(3'-5')pA(3'-5')pG(3'-5')p(3-) 3',3',3'-cAAG 3',3',3'-cAAGMP(3-) |
| id |
CHEBI:143810 |
| in_subset | |
| inchi |
InChI=1S/C30H36N15O19P3/c31-21-12-23(36-4-34-21)43(6-38-12)27-15(46)18-10(60-27)2-57-67(54,55)64-20-11(61-29(17(20)48)45-8-40-14-25(45)41-30(33)42-26(14)49)3-58-66(52,53)63-19-9(1-56-65(50,51)62-18)59-28(16(19)47)44-7-39-13-22(32)35-5-37-24(13)44/h4-11,15-20,27-29,46-48H,1-3H2,(H,50,51)(H,52,53)(H,54,55)(H2,31,34,36)(H2,32,35,37)(H3,33,41,42,49)/p-3/t9-,10-,11-,15-,16-,17-,18-,19-,20-,27-,28-,29-/m1/s1 |
| inchikey |
OCQIWYNXZJSERX-ZQWUJQRXSA-K |
| label |
cyclic AMP-AMP-GMP(3-) |
| mass |
1000.603 |
| monoisotopicmass |
1000.13065 |
| notation |
CHEBI:143810 |
| prefLabel |
cyclic AMP-AMP-GMP(3-) |
| smiles |
[C@@H]1(N2C3=C(C(=O)NC(=N3)N)N=C2)O[C@H]4[C@H]([C@H]1O)OP(=O)([O-])OC[C@H]5O[C@@H](N6C7=C(C(N)=NC=N7)N=C6)[C@@H]([C@@H]5OP(=O)(OC[C@H]8O[C@@H](N9C%10=C(C(N)=NC=N%10)N=C9)[C@@H]([C@@H]8OP(OC4)(=O)[O-])O)[O-])O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||