Jump to:
loading...| Preferred Name |
fragin zwitterion |
| Definitions |
A diazeniumdiolate natural product found in Burkholderia cenocepacia with an antifungal activity. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_156352 |
| charge |
0 |
| database_cross_reference |
PMID:29602945 PMID:31945256 |
| definition |
A diazeniumdiolate natural product found in Burkholderia cenocepacia with an antifungal activity. |
| formula |
C13H27N3O3 |
| has part | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_33282 |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:156352 |
| in_subset | |
| inchi |
InChI=1S/C13H27N3O3/c1-4-5-6-7-8-9-13(17)14-10-12(11(2)3)16(19)15-18/h11-12,18H,4-10H2,1-3H3,(H,14,17)/b16-15- |
| inchikey |
SXMAXSCAVUEAAA-NXVVXOECSA-N |
| is tautomer of | |
| label |
fragin zwitterion |
| mass |
273.377 |
| monoisotopicmass |
273.20524 |
| notation |
CHEBI:156352 |
| prefLabel |
fragin zwitterion |
| smiles |
CCCCCCCC(=O)NCC(C(C)C)/[N+](=N/O)/[O-] |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_32988 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32988 |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||