loading...| Preferred Name |
4-methylcyclohexanemethanol |
| Synonyms |
4-methylcyclohexyl-1-carbinol 4-methylcyclohexylmethanol MCHM 4-methylcyclohexane methanol 4-methylcyclohexane-1-methanol 4-MCHM (4-methylcyclohexyl)methanol p-methylcyclohexanemethanol 4-methylcyclohexylcarbinol 4-methyl-1-cyclohexanemethanol hexahydro-p-tolyl-carbinol 1-(hydroxymethyl)-4-methylcyclohexane |
| Definitions |
An alicyclic primary alcohol that is cyclohexane substituted by a hydroxy methyl group and methyl group at positions 1 and 4. It acts as a hydrotrope, solubilizing hydrophobic substances in aqueous environments. It also prevents protein aggregation, alters membrane dynamics and metal homeostasis, and is used in a flotation process for cleaning and processing coal. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_157744 |
| charge |
0 |
| database_cross_reference |
PMID:26780132 PMID:28942244 PMID:28692341 PMID:27219291 PMID:28277879 Reaxys:3028953 Chemspider:105625 PMID:25961958 PMID:27218124 PMID:26509789 PMID:31622418 PMID:32749828 PMID:28942635 PMID:27539822 PMID:32970398 PMID:28492684 PMID:25541902 PMID:31392542 PMID:26745518 Wikipedia:4-Methylcyclohexanemethanol PMID:28357716 PMID:26311585 PMID:28343035 PMID:33109726 PMID:25513829 PMID:25542639 CAS:34885-03-5 |
| definition |
An alicyclic primary alcohol that is cyclohexane substituted by a hydroxy methyl group and methyl group at positions 1 and 4. It acts as a hydrotrope, solubilizing hydrophobic substances in aqueous environments. It also prevents protein aggregation, alters membrane dynamics and metal homeostasis, and is used in a flotation process for cleaning and processing coal. |
| formula |
C8H16O |
| has_exact_synonym |
(4-methylcyclohexyl)methanol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
4-methylcyclohexyl-1-carbinol 4-methylcyclohexylmethanol MCHM 4-methylcyclohexane methanol 4-methylcyclohexane-1-methanol 4-MCHM p-methylcyclohexanemethanol 4-methylcyclohexylcarbinol 4-methyl-1-cyclohexanemethanol hexahydro-p-tolyl-carbinol 1-(hydroxymethyl)-4-methylcyclohexane |
| id |
CHEBI:157744 |
| in_subset | |
| inchi |
InChI=1S/C8H16O/c1-7-2-4-8(6-9)5-3-7/h7-9H,2-6H2,1H3 |
| inchikey |
OSINZLLLLCUKJH-UHFFFAOYSA-N |
| label |
4-methylcyclohexanemethanol |
| mass |
128.215 |
| monoisotopicmass |
128.12012 |
| notation |
CHEBI:157744 |
| prefLabel |
4-methylcyclohexanemethanol |
| smiles |
CC1CCC(CO)CC1 |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_33598 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33598 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C000607184 | Medical Subject Headings / 医学主题词表 | LOOM |