loading...| Preferred Name |
12-demethylmultiorthoquinone |
| Synonyms |
2-hydroxy-11,12-dioxoabieta-1,3,5(10),6,8,13-hexaene 6-hydroxy-7,8-dimethyl-2-propan-2-ylphenanthrene-3,4-dione |
| Definitions |
A diterpenoid that is multiorthoquinone in which the methoxy group at position 12 is replaced by a hydroxy group. A norabietane derivative, it is isolated from Salvia multicaulis and exhibits antitubercular activity. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_66410 |
| charge |
0 |
| database_cross_reference |
Reaxys:7875836 PMID:9428161 |
| definition |
A diterpenoid that is multiorthoquinone in which the methoxy group at position 12 is replaced by a hydroxy group. A norabietane derivative, it is isolated from Salvia multicaulis and exhibits antitubercular activity. |
| formula |
C19H18O3 |
| has role | |
| has_exact_synonym |
6-hydroxy-7,8-dimethyl-2-propan-2-ylphenanthrene-3,4-dione |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-hydroxy-11,12-dioxoabieta-1,3,5(10),6,8,13-hexaene |
| id |
CHEBI:66410 |
| in_subset | |
| inchi |
InChI=1S/C19H18O3/c1-9(2)14-7-12-5-6-13-10(3)11(4)16(20)8-15(13)17(12)19(22)18(14)21/h5-9,20H,1-4H3 |
| inchikey |
OVYJWDSHGYTZSE-UHFFFAOYSA-N |
| label |
12-demethylmultiorthoquinone |
| mass |
294.34440 |
| monoisotopicmass |
294.12559 |
| notation |
CHEBI:66410 |
| prefLabel |
12-demethylmultiorthoquinone |
| smiles |
CC(C)C1=Cc2ccc3c(C)c(C)c(O)cc3c2C(=O)C1=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_25622 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25622 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||