loading...| Preferred Name |
9-phenanthrol |
| Synonyms |
9-phenanthrenol 9-Phenanthrol phenanthren-9-ol 9-Hydroxyphenanthrene |
| Definitions |
A phenanthrol that is phenanthrene in which a hydrogen attached to a carbon in the central ring has been replaced by a hydroxy group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_28820 |
| charge |
0 |
| database_cross_reference |
PMID:22014185 PMID:24037125 PMID:23831210 PMID:22815468 UM-BBD_compID:c0454 PMID:25573456 KEGG:C11430 PMID:23936231 CAS:484-17-3 PMID:18297105 PMID:24433510 PMID:25323322 HMDB:HMDB0059801 |
| definition |
A phenanthrol that is phenanthrene in which a hydrogen attached to a carbon in the central ring has been replaced by a hydroxy group. |
| formula |
C14H10O |
| has parent hydride | |
| has role | |
| has_alternative_id |
CHEBI:20829 CHEBI:2334 |
| has_exact_synonym |
9-Phenanthrol phenanthren-9-ol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
9-phenanthrenol 9-Hydroxyphenanthrene |
| id |
CHEBI:28820 |
| in_subset | |
| inchi |
InChI=1S/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
| inchikey |
DZKIUEHLEXLYKM-UHFFFAOYSA-N |
| label |
9-phenanthrol |
| mass |
194.22860 |
| monoisotopicmass |
194.07316 |
| notation |
CHEBI:28820 |
| prefLabel |
9-phenanthrol |
| smiles |
Oc1cc2ccccc2c2ccccc12 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C091375 | Medical Subject Headings / 医学主题词表 | LOOM |