Jump to:
loading...| Preferred Name |
1-phenanthryl sulfate |
| Synonyms |
1-phenanthrylsulfate 1-phenanthryl sulfate |
| ID |
http://purl.obolibrary.org/obo/CHEBI_19083 |
| charge |
-1 |
| database_cross_reference |
UM-BBD_compID:c0535 |
| formula |
C14H9O4S |
| has_exact_synonym |
1-phenanthryl sulfate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
1-phenanthrylsulfate |
| id |
CHEBI:19083 |
| in_subset | |
| inchi |
InChI=1S/C14H10O4S/c15-19(16,17)18-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H,(H,15,16,17)/p-1 |
| inchikey |
KSLTXOSGWUKDQR-UHFFFAOYSA-M |
| is conjugate base of | |
| label |
1-phenanthryl sulfate |
| mass |
273.28486 |
| monoisotopicmass |
273.02270 |
| notation |
CHEBI:19083 |
| prefLabel |
1-phenanthryl sulfate |
| smiles |
[O-]S(=O)(=O)Oc1cccc2c1ccc1ccccc21 |
| treeView | |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||