loading...| Preferred Name |
N-[4-(4-nitrophenylphospho)butanoyl]alanine |
| Synonyms |
N-{4-[hydroxy(4-nitrophenoxy)phosphoryl]butanoyl}alanine N-[4-[hydroxy(4-nitrophenoxy)phosphinyl]-1-oxobutyl]alanine |
| Definitions |
An alanine derivative having a 4-(4-nitrophenylphospho)butanoyl group attached to the nitrogen of alanine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_59566 |
| charge |
0 |
| definition |
An alanine derivative having a 4-(4-nitrophenylphospho)butanoyl group attached to the nitrogen of alanine. |
| formula |
C13H17N2O8P |
| has_exact_synonym |
N-{4-[hydroxy(4-nitrophenoxy)phosphoryl]butanoyl}alanine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N-[4-[hydroxy(4-nitrophenoxy)phosphinyl]-1-oxobutyl]alanine |
| id |
CHEBI:59566 |
| in_subset | |
| inchi |
InChI=1S/C13H17N2O8P/c1-9(13(17)18)14-12(16)3-2-8-24(21,22)23-11-6-4-10(5-7-11)15(19)20/h4-7,9H,2-3,8H2,1H3,(H,14,16)(H,17,18)(H,21,22) |
| inchikey |
KBXXIYHMPQZHCH-UHFFFAOYSA-N |
| label |
N-[4-(4-nitrophenylphospho)butanoyl]alanine |
| mass |
360.25640 |
| monoisotopicmass |
360.07225 |
| notation |
CHEBI:59566 |
| prefLabel |
N-[4-(4-nitrophenylphospho)butanoyl]alanine |
| smiles |
CC(NC(=O)CCCP(O)(=O)Oc1ccc(cc1)[N+]([O-])=O)C(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22278 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22278 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||