loading...| Preferred Name |
cyclic A(3'-5')pA(3'-5')pA(3'-5')p(3-) |
| Synonyms |
3'3'3'-cAAA 3',3',3'-c-tri-AMP 3'3'3'-cyclic AMP-AMP-AMP |
| Definitions |
An organophosphate oxoanion obtained by deprotonation of the phosphate OH groups of cyclic A(3'-5')pA(3'-5')pA(3'-5')p; major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_192523 |
| charge |
-3 |
| database_cross_reference |
PMID:31932165 PMID:35395152 |
| definition |
An organophosphate oxoanion obtained by deprotonation of the phosphate OH groups of cyclic A(3'-5')pA(3'-5')pA(3'-5')p; major species at pH 7.3. |
| formula |
C30H33N15O18P3 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
3'3'3'-cAAA 3',3',3'-c-tri-AMP 3'3'3'-cyclic AMP-AMP-AMP |
| id |
CHEBI:192523 |
| in_subset | |
| inchi |
InChI=1S/C30H36N15O18P3/c31-22-13-25(37-4-34-22)43(7-40-13)28-16(46)19-10(58-28)1-55-64(49,50)62-20-11(59-29(17(20)47)44-8-41-14-23(32)35-5-38-26(14)44)2-57-66(53,54)63-21-12(3-56-65(51,52)61-19)60-30(18(21)48)45-9-42-15-24(33)36-6-39-27(15)45/h4-12,16-21,28-30,46-48H,1-3H2,(H,49,50)(H,51,52)(H,53,54)(H2,31,34,37)(H2,32,35,38)(H2,33,36,39)/p-3/t10-,11-,12-,16-,17-,18-,19-,20-,21-,28-,29-,30-/m1/s1 |
| inchikey |
OEJXFVYXZQYNND-UQTMIEBXSA-K |
| label |
cyclic A(3'-5')pA(3'-5')pA(3'-5')p(3-) |
| mass |
984.604 |
| monoisotopicmass |
984.13573 |
| notation |
CHEBI:192523 |
| prefLabel |
cyclic A(3'-5')pA(3'-5')pA(3'-5')p(3-) |
| smiles |
[C@@H]1(N2C3=C(C(N)=NC=N3)N=C2)O[C@H]4[C@H]([C@H]1O)OP(=O)([O-])OC[C@H]5O[C@@H](N6C7=C(C(N)=NC=N7)N=C6)[C@@H]([C@@H]5OP([O-])(=O)OC[C@H]8O[C@@H](N9C%10=C(C(N)=NC=N%10)N=C9)[C@@H]([C@@H]8OP(OC4)(=O)[O-])O)O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_7754 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_7754 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||