Jump to:
loading...| Preferred Name |
4-phenylbutyrate |
| Synonyms |
4-phenylbutanoate |
| Definitions |
A carboxylic acid anion obtained by the removal of proton from the carboxy group of 4-phenylbutyric acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_75317 |
| charge |
-1 |
| database_cross_reference |
LINCS:LSM-6715 Reaxys:3665832 MetaCyc:CPD-14367 |
| definition |
A carboxylic acid anion obtained by the removal of proton from the carboxy group of 4-phenylbutyric acid. |
| formula |
C10H11O2 |
| has_exact_synonym |
4-phenylbutanoate |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:75317 |
| in_subset | |
| inchi |
InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12)/p-1 |
| inchikey |
OBKXEAXTFZPCHS-UHFFFAOYSA-M |
| is conjugate base of | |
| label |
4-phenylbutyrate |
| mass |
163.19310 |
| monoisotopicmass |
163.07645 |
| notation |
CHEBI:75317 |
| prefLabel |
4-phenylbutyrate |
| smiles |
[O-]C(=O)CCCc1ccccc1 |
| treeView | |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||