loading...| Preferred Name |
N(6)-(5'-adenylyl)-L-lysine |
| Synonyms |
AMP-lysine |
| Definitions |
An L-lysine derivative that is the phosphoramidate obtained by formal condensation of the phosphate group of AMP with the side-chain amino group of L-lysine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_21868 |
| charge |
0 |
| definition |
An L-lysine derivative that is the phosphoramidate obtained by formal condensation of the phosphate group of AMP with the side-chain amino group of L-lysine. |
| formula |
C16H26N7O8P |
| has functional parent | |
| has role | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
AMP-lysine |
| id |
CHEBI:21868 |
| in_subset | |
| inchi |
InChI=1S/C16H26N7O8P/c17-8(16(26)27)3-1-2-4-22-32(28,29)30-5-9-11(24)12(25)15(31-9)23-7-21-10-13(18)19-6-20-14(10)23/h6-9,11-12,15,24-25H,1-5,17H2,(H,26,27)(H2,18,19,20)(H2,22,28,29)/t8-,9+,11+,12+,15+/m0/s1 |
| inchikey |
WEMWOGPFXCHOOW-OPYVMVOTSA-N |
| label |
N(6)-(5'-adenylyl)-L-lysine |
| mass |
475.394 |
| monoisotopicmass |
475.15805 |
| notation |
CHEBI:21868 |
| prefLabel |
N(6)-(5'-adenylyl)-L-lysine |
| smiles |
NC1=NC=NC2=C1N=CN2[C@@H]3O[C@H](COP(=O)(NCCCC[C@@H](C(O)=O)N)O)[C@@H](O)[C@H]3O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_48116 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48116 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||