loading...| Preferred Name |
laccaridione B |
| Synonyms |
1-ethoxy-10-hydroxy-7-methoxy-3-[(2E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione |
| Definitions |
An organic heterotricyclic compound that is 1H-benzo[g]isochromene-8,9-dione substituted by an ethoxy group at position 1, hydroxy group at position 10, a methoxy group at position 7 and a 4-methylhex-2-en-2-yl group at position 3. Isolated from the stem of the fruiting bodies of the basidiomycete strain Laccaria amethystea, it exhibits inhibitory activity against proteases. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_66541 |
| charge |
0 |
| database_cross_reference |
PMID:11213295 Patent:DE10037982 Reaxys:8726721 Patent:DE10349511 PMID:18422912 |
| definition |
An organic heterotricyclic compound that is 1H-benzo[g]isochromene-8,9-dione substituted by an ethoxy group at position 1, hydroxy group at position 10, a methoxy group at position 7 and a 4-methylhex-2-en-2-yl group at position 3. Isolated from the stem of the fruiting bodies of the basidiomycete strain Laccaria amethystea, it exhibits inhibitory activity against proteases. |
| formula |
C23H26O6 |
| has role | |
| has_exact_synonym |
1-ethoxy-10-hydroxy-7-methoxy-3-[(2E)-4-methylhex-2-en-2-yl]-1H-benzo[g]isochromene-8,9-dione |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:66541 |
| in_subset | |
| inchi |
InChI=1S/C23H26O6/c1-6-12(3)8-13(4)16-10-15-9-14-11-17(27-5)20(24)22(26)18(14)21(25)19(15)23(29-16)28-7-2/h8-12,23,25H,6-7H2,1-5H3/b13-8+ |
| inchikey |
UMMLLCGZZRNVRG-MDWZMJQESA-N |
| label |
laccaridione B |
| mass |
398.44890 |
| monoisotopicmass |
398.17294 |
| notation |
CHEBI:66541 |
| prefLabel |
laccaridione B |
| smiles |
CCOC1OC(=Cc2cc3C=C(OC)C(=O)C(=O)c3c(O)c12)C(C)=C\C(C)CC |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_59770 http://purl.obolibrary.org/obo/CHEBI_25622 http://purl.obolibrary.org/obo/CHEBI_38761 http://purl.obolibrary.org/obo/CHEBI_26979 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_59770 http://purl.obolibrary.org/obo/CHEBI_25622 http://purl.obolibrary.org/obo/CHEBI_38761 http://purl.obolibrary.org/obo/CHEBI_26979 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C420731 | Medical Subject Headings / 医学主题词表 | LOOM |