| Preferred Name |
N-acetylputrescine |
| Synonyms |
N-(4-aminobutyl)acetamide N-Acetylputrescine |
| Definitions |
An N-monoacetylalkane-alpha,omega-diamine that is the N-monoacetyl derivative of putrescine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17768 |
| charge |
0 |
| database_cross_reference |
PMID:7663691 PMID:22770225 PMID:6257381 PMID:16232710 PMID:23081916 PMID:197226 PMID:3627168 CAS:5699-41-2 KEGG:C02714 Reaxys:1749697 HMDB:HMDB0002064 PMID:15073218 PMID:2775189 PMID:10198034 MetaCyc:CPD-569 PMID:894508 PMID:7817785 PMID:7092834 CAS:18233-70-0 PMID:7406885 PMID:2320051 PMID:8955325 PMID:7630314 PMID:8441357 |
| definition |
An N-monoacetylalkane-alpha,omega-diamine that is the N-monoacetyl derivative of putrescine. |
| formula |
C6H14N2O |
| has_alternative_id |
CHEBI:21629 CHEBI:7222 CHEBI:12473 |
| has_exact_synonym |
N-(4-aminobutyl)acetamide N-Acetylputrescine |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:17768 |
| in_subset | |
| inchi |
InChI=1S/C6H14N2O/c1-6(9)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9) |
| inchikey |
KLZGKIDSEJWEDW-UHFFFAOYSA-N |
| label |
N-acetylputrescine |
| mass |
130.18824 |
| monoisotopicmass |
130.11061 |
| notation |
CHEBI:17768 |
| prefLabel |
N-acetylputrescine |
| smiles |
CC(=O)NCCCCN |
| subClassOf |