loading...| Preferred Name |
multicaulin |
| Synonyms |
6-methoxy-1,2-dimethyl-7-(propan-2-yl)phenanthrene 7,8-dimethyl-2-(propan-2-yl)phenanthren-3-yl methyl ether 12-methoxy-abieta-1,3,5(10),6,8,11,13-heptaene |
| Definitions |
A diterpenoid that is phenanthrene substituted by a methoxy group at position 6, methyl groups at position 1 and 2 and an isopropyl group at position 7. A norabietane derivative, it is isolated from the roots of Salvia multicaulis and exhibits antitubercular activity. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_66407 |
| charge |
0 |
| database_cross_reference |
Reaxys:7874294 PMID:9428161 |
| definition |
A diterpenoid that is phenanthrene substituted by a methoxy group at position 6, methyl groups at position 1 and 2 and an isopropyl group at position 7. A norabietane derivative, it is isolated from the roots of Salvia multicaulis and exhibits antitubercular activity. |
| formula |
C20H22O |
| has role | |
| has_exact_synonym |
6-methoxy-1,2-dimethyl-7-(propan-2-yl)phenanthrene |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
7,8-dimethyl-2-(propan-2-yl)phenanthren-3-yl methyl ether 12-methoxy-abieta-1,3,5(10),6,8,11,13-heptaene |
| id |
CHEBI:66407 |
| in_subset | |
| inchi |
InChI=1S/C20H22O/c1-12(2)18-10-15-7-9-16-14(4)13(3)6-8-17(16)19(15)11-20(18)21-5/h6-12H,1-5H3 |
| inchikey |
QSZDTCGHFRXGFB-UHFFFAOYSA-N |
| label |
multicaulin |
| mass |
278.38810 |
| monoisotopicmass |
278.16707 |
| notation |
CHEBI:66407 |
| prefLabel |
multicaulin |
| smiles |
COc1cc2c(ccc3c(C)c(C)ccc23)cc1C(C)C |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C000594635 | Medical Subject Headings / 医学主题词表 | LOOM |