loading...| Preferred Name |
4-hydroxy-3-all-trans-decaprenylbenzoic acid |
| Synonyms |
Pphb-10 3-decaprenyl-4-hydroxybenzoic acid 3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4-hydroxybenzoic acid 3-Decaprenyl-4-hydroxybenzoate |
| Definitions |
A monohydroxybenzoic acid that is 4-hydroxybenzoic acid in which the hydrogen at position 3 is substituted by a decaprenyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_64136 |
| charge |
0 |
| database_cross_reference |
PMID:2347426 PMID:2916849 CAS:636-57-7 PMID:836803 |
| definition |
A monohydroxybenzoic acid that is 4-hydroxybenzoic acid in which the hydrogen at position 3 is substituted by a decaprenyl group. |
| formula |
C57H86O3 |
| has_exact_synonym |
3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4-hydroxybenzoic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Pphb-10 3-decaprenyl-4-hydroxybenzoic acid 3-Decaprenyl-4-hydroxybenzoate |
| id |
CHEBI:64136 |
| in_subset | |
| inchi |
InChI=1S/C57H86O3/c1-44(2)21-12-22-45(3)23-13-24-46(4)25-14-26-47(5)27-15-28-48(6)29-16-30-49(7)31-17-32-50(8)33-18-34-51(9)35-19-36-52(10)37-20-38-53(11)39-40-54-43-55(57(59)60)41-42-56(54)58/h21,23,25,27,29,31,33,35,37,39,41-43,58H,12-20,22,24,26,28,30,32,34,36,38,40H2,1-11H3,(H,59,60)/b45-23+,46-25+,47-27+,48-29+,49-31+,50-33+,51-35+,52-37+,53-39+ |
| inchikey |
CMPNJZREBHCPHN-LTNIBBDRSA-N |
| is conjugate acid of | |
| label |
4-hydroxy-3-all-trans-decaprenylbenzoic acid |
| mass |
819.29090 |
| monoisotopicmass |
818.65770 |
| notation |
CHEBI:64136 |
| prefLabel |
4-hydroxy-3-all-trans-decaprenylbenzoic acid |
| smiles |
CC(C)=CCCC(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\Cc1cc(ccc1O)C(O)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||