loading...| Preferred Name |
N-methyldopa |
| Synonyms |
3-hydroxy-N-methyltyrosine beta-(3,4-dihydroxyphenyl)-N-methyl-alanine 3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic acid N-methyl-dopa N-methyl-3,4-dihydroxyphenylalanine |
| Definitions |
A tyrosine derivative that is dopa in which one of the hydrogens of the amino group is replaced by a methyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_167648 |
| charge |
0 |
| database_cross_reference |
PMID:30194285 PMID:716472 PMID:27065235 CAS:53663-27-7 |
| definition |
A tyrosine derivative that is dopa in which one of the hydrogens of the amino group is replaced by a methyl group. |
| formula |
C10H13NO4 |
| has functional parent | |
| has_exact_synonym |
3-hydroxy-N-methyltyrosine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
beta-(3,4-dihydroxyphenyl)-N-methyl-alanine 3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic acid N-methyl-dopa N-methyl-3,4-dihydroxyphenylalanine |
| id |
CHEBI:167648 |
| in_subset | |
| inchi |
InChI=1S/C10H13NO4/c1-11-7(10(14)15)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,11-13H,4H2,1H3,(H,14,15) |
| inchikey |
QZIWDCLHLOADPK-UHFFFAOYSA-N |
| label |
N-methyldopa |
| mass |
211.217 |
| monoisotopicmass |
211.08446 |
| notation |
CHEBI:167648 |
| prefLabel |
N-methyldopa |
| smiles |
CNC(CC1=CC=C(O)C(O)=C1)C(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_83925 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83925 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||