loading...| Preferred Name |
ethylenebis(dithiocarbamic acid) |
| Synonyms |
N,N'-ethanediylbis(dithiocarbamic acid) ethane-1,2-diyldicarbamodithioic acid ethylenebisdithiocarbamic acid N,N'-(ethylene)bisdithiocarbamic acid |
| Definitions |
A dithiocarbamic acid resulting from the formal addition of a molecule of carbon disulfide to each amino group of ethylenediamine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_83986 |
| charge |
0 |
| database_cross_reference |
Reaxys:1772091 CAS:111-54-6 |
| definition |
A dithiocarbamic acid resulting from the formal addition of a molecule of carbon disulfide to each amino group of ethylenediamine. |
| formula |
C4H8N2S4 |
| has functional parent | |
| has_exact_synonym |
ethane-1,2-diyldicarbamodithioic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N,N'-ethanediylbis(dithiocarbamic acid) ethylenebisdithiocarbamic acid N,N'-(ethylene)bisdithiocarbamic acid |
| id |
CHEBI:83986 |
| in_subset | |
| inchi |
InChI=1S/C4H8N2S4/c7-3(8)5-1-2-6-4(9)10/h1-2H2,(H2,5,7,8)(H2,6,9,10) |
| inchikey |
AWYFNIZYMPNGAI-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
ethylenebis(dithiocarbamic acid) |
| mass |
212.38000 |
| monoisotopicmass |
211.95703 |
| notation |
CHEBI:83986 |
| prefLabel |
ethylenebis(dithiocarbamic acid) |
| smiles |
SC(=S)NCCNC(S)=S |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||