loading...| Preferred Name |
cytonic acid A |
| Synonyms |
4-({4-[(2,4-dihydroxy-6-pentylbenzoyl)oxy]-2-hydroxy-6-propylbenzoyl}oxy)-2-hydroxy-6-propylbenzoic acid |
| Definitions |
A benzoate ester obtained by the formal condensation of the hydroxy group at position 4 of 4-[(2,4-dihydroxy-6-propylbenzoyl)oxy]-2-hydroxy-6-propylbenzoic acid with the carboxy group of 2,4-dihydroxy-6-pentylbenzoic acid (olivetolic acid). It is isolated from the endophytic fungi Cytonaema and acts as an inhibitor of human cytomegalovirus (hCMV) protease. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_65717 |
| charge |
0 |
| database_cross_reference |
PMID:10843568 Reaxys:8667623 |
| definition |
A benzoate ester obtained by the formal condensation of the hydroxy group at position 4 of 4-[(2,4-dihydroxy-6-propylbenzoyl)oxy]-2-hydroxy-6-propylbenzoic acid with the carboxy group of 2,4-dihydroxy-6-pentylbenzoic acid (olivetolic acid). It is isolated from the endophytic fungi Cytonaema and acts as an inhibitor of human cytomegalovirus (hCMV) protease. |
| formula |
C32H36O10 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_22587 |
| has_exact_synonym |
4-({4-[(2,4-dihydroxy-6-pentylbenzoyl)oxy]-2-hydroxy-6-propylbenzoyl}oxy)-2-hydroxy-6-propylbenzoic acid |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:65717 |
| in_subset | |
| inchi |
InChI=1S/C32H36O10/c1-4-7-8-11-20-12-21(33)15-24(34)29(20)32(40)42-23-14-19(10-6-3)28(26(36)17-23)31(39)41-22-13-18(9-5-2)27(30(37)38)25(35)16-22/h12-17,33-36H,4-11H2,1-3H3,(H,37,38) |
| inchikey |
SQZYUOYBTIOEEA-UHFFFAOYSA-N |
| label |
cytonic acid A |
| mass |
580.62220 |
| monoisotopicmass |
580.23085 |
| notation |
CHEBI:65717 |
| prefLabel |
cytonic acid A |
| smiles |
CCCCCc1cc(O)cc(O)c1C(=O)Oc1cc(O)c(C(=O)Oc2cc(O)c(C(O)=O)c(CCC)c2)c(CCC)c1 |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_33572 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33572 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C410913 | Medical Subject Headings / 医学主题词表 | LOOM |