loading...| Preferred Name |
acridine orange |
| Synonyms |
3,6-Bis(dimethylamino)acridine 3,6-Bis(dimethylamino)acridine hydrochloride N,N,N',N'-tetramethylacridine-3,6-diamine hydrochloride Rhoduline Orange basic orange 14 N3,N3,N6,N6-tetramethyl-3,6-Acridinediamine hydrochloride(1:1) C.I. 46005 |
| Definitions |
Fluorescent dye useful for cell cycle determination. It is cell-permeable, and interacts with DNA and RNA by intercalation or electrostatic attractions respectively. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_51739 |
| charge |
0 |
| database_cross_reference |
KEGG:C19315 CAS:494-38-2 CAS:65-61-2 Beilstein:3575587 Wikipedia:Acridine_orange |
| definition |
Fluorescent dye useful for cell cycle determination. It is cell-permeable, and interacts with DNA and RNA by intercalation or electrostatic attractions respectively. |
| formula |
C17H19N3.ClH C17H20ClN3 |
| has part | |
| has role | |
| has_exact_synonym |
N,N,N',N'-tetramethylacridine-3,6-diamine hydrochloride |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
3,6-Bis(dimethylamino)acridine 3,6-Bis(dimethylamino)acridine hydrochloride Rhoduline Orange basic orange 14 N3,N3,N6,N6-tetramethyl-3,6-Acridinediamine hydrochloride(1:1) C.I. 46005 |
| id |
CHEBI:51739 |
| in_subset | |
| inchi |
InChI=1S/C17H19N3.ClH/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14;/h5-11H,1-4H3;1H |
| inchikey |
VSTHNGLPHBTRMB-UHFFFAOYSA-N |
| label |
acridine orange |
| mass |
301.81362 |
| monoisotopicmass |
301.13458 |
| notation |
CHEBI:51739 |
| prefLabel |
acridine orange |
| smiles |
[H+].[Cl-].CN(C)c1ccc2cc3ccc(cc3nc2c1)N(C)C |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/D000165 | Medical Subject Headings / 医学主题词表 | LOOM |