loading...| Preferred Name |
N-palmitoyl-L-cysteine |
| Synonyms |
(2R)-2-(hexadecanoylamino)-3-sulfanylpropanoic acid (R)-2-hexadecanoylamino-3-mercaptopropanoic acid N-palmitoyl-L-cysteine N-hexadecanoyl-L-cysteine N-(1-oxohexadecyl)-L-cysteine |
| Definitions |
A palmitoyl-L-cysteine in which the palmitoyl group is attached to the nitrogen via an amide linkage. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_21780 |
| charge |
0 |
| database_cross_reference |
CAS:67603-49-0 PMID:3558391 PMID:10495889 PMID:30393067 |
| definition |
A palmitoyl-L-cysteine in which the palmitoyl group is attached to the nitrogen via an amide linkage. |
| formula |
C19H37NO3S |
| has_exact_synonym |
N-palmitoyl-L-cysteine N-hexadecanoyl-L-cysteine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(2R)-2-(hexadecanoylamino)-3-sulfanylpropanoic acid (R)-2-hexadecanoylamino-3-mercaptopropanoic acid N-(1-oxohexadecyl)-L-cysteine |
| id |
CHEBI:21780 |
| in_subset | |
| inchi |
InChI=1S/C19H37NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)20-17(16-24)19(22)23/h17,24H,2-16H2,1H3,(H,20,21)(H,22,23)/t17-/m0/s1 |
| inchikey |
YYHOQQKJSHXDEN-KRWDZBQOSA-N |
| label |
N-palmitoyl-L-cysteine |
| mass |
359.570 |
| monoisotopicmass |
359.24942 |
| notation |
CHEBI:21780 |
| prefLabel |
N-palmitoyl-L-cysteine |
| smiles |
OC([C@@H](NC(=O)CCCCCCCCCCCCCCC)CS)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/MOD_00069 | Protein Ontology / 蛋白质本体 | LOOM |