Jump to:
loading...| Preferred Name |
4-(trimethylammonio)but-2-enoate |
| Synonyms |
4-(trimethylammonio)but-2-enoate |
| ID |
http://purl.obolibrary.org/obo/CHEBI_11946 |
| charge |
0 |
| database_cross_reference |
Beilstein:3904235 |
| formula |
C7H13NO2 |
| has functional parent | |
| has_exact_synonym |
4-(trimethylammonio)but-2-enoate |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:11946 |
| in_subset | |
| inchi |
InChI=1S/C7H13NO2/c1-8(2,3)6-4-5-7(9)10/h4-5H,6H2,1-3H3 |
| inchikey |
GUYHPGUANSLONG-UHFFFAOYSA-N |
| is conjugate base of | |
| label |
4-(trimethylammonio)but-2-enoate |
| mass |
143.18366 |
| monoisotopicmass |
143.09463 |
| notation |
CHEBI:11946 |
| prefLabel |
4-(trimethylammonio)but-2-enoate |
| smiles |
[H]C(C[N+](C)(C)C)=CC([O-])=O |
| treeView | |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||