loading...| Preferred Name |
phenoxyacetic acid |
| Synonyms |
Phenoxyacetate POA Phenoxyacetic acid Glycol acid phenyl ether Phenoxyessigsaeure phenoxyethanoic acid phenoxacetic acid phenoxyacetic acid |
| Definitions |
A monocarboxylic acid that is the O-phenyl derivative of glycolic acid. A metabolite of 2-phenoxyethanol, it is used in the manufacture of pharmaceuticals, pesticides, fungicides and dyes. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_8075 |
| charge |
0 |
| database_cross_reference |
PDBeChem:06Y PMID:26452788 PMID:14687482 KEGG:C02181 Beilstein:907949 PMID:23838187 Reaxys:907949 CAS:122-59-8 PMID:26188115 Gmelin:142730 HMDB:HMDB0031609 |
| definition |
A monocarboxylic acid that is the O-phenyl derivative of glycolic acid. A metabolite of 2-phenoxyethanol, it is used in the manufacture of pharmaceuticals, pesticides, fungicides and dyes. |
| formula |
C8H8O3 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_76956 http://purl.obolibrary.org/obo/CHEBI_76967 |
| has_exact_synonym |
Phenoxyacetic acid phenoxyacetic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Phenoxyacetate POA Glycol acid phenyl ether Phenoxyessigsaeure phenoxyethanoic acid phenoxacetic acid |
| id |
CHEBI:8075 |
| in_subset | |
| inchi |
InChI=1S/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| inchikey |
LCPDWSOZIOUXRV-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
phenoxyacetic acid |
| mass |
152.14732 |
| monoisotopicmass |
152.04734 |
| notation |
CHEBI:8075 |
| prefLabel |
phenoxyacetic acid |
| smiles |
OC(=O)COc1ccccc1 |
| treeView | |
| subClassOf |