loading...| Preferred Name |
2,6-di-tert-butylphenol |
| Synonyms |
2,6-Bis(1,1-dimethylethyl)phenol 2,6-Di-t-butylphenol 2,6-Bis(t-butyl)phenol 2,6-di-tert-butylphenol 2,6-(1,1-Dimethylethyl)phenol 2,6-Bis(tert-butyl)phenol |
| Definitions |
A member of the class of phenols carrying two tert-butyl substituents at positions 2 and 6. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_131421 |
| charge |
0 |
| database_cross_reference |
PMID:27506338 Chemspider:29135 Reaxys:1841887 Wikipedia:2,6-Di-tert-butylphenol CAS:128-39-2 PMID:27279638 PMID:27454828 |
| definition |
A member of the class of phenols carrying two tert-butyl substituents at positions 2 and 6. |
| formula |
C14H22O |
| has role | |
| has_exact_synonym |
2,6-di-tert-butylphenol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2,6-Bis(1,1-dimethylethyl)phenol 2,6-Di-t-butylphenol 2,6-Bis(t-butyl)phenol 2,6-(1,1-Dimethylethyl)phenol 2,6-Bis(tert-butyl)phenol |
| id |
CHEBI:131421 |
| in_subset | |
| inchi |
InChI=1S/C14H22O/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6/h7-9,15H,1-6H3 |
| inchikey |
DKCPKDPYUFEZCP-UHFFFAOYSA-N |
| label |
2,6-di-tert-butylphenol |
| mass |
206.324 |
| monoisotopicmass |
206.16707 |
| notation |
CHEBI:131421 |
| prefLabel |
2,6-di-tert-butylphenol |
| smiles |
OC1=C(C(C)(C)C)C=CC=C1C(C)(C)C |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C035407 | Medical Subject Headings / 医学主题词表 | LOOM |