loading...| Preferred Name |
(-)-beta-selinene |
| Synonyms |
(4aS,7S,8aR)-7-isopropenyl-4a-methyl-1-methylenedecahydronaphthalene (5beta,7alpha,10alpha)-eudesma-4(14),11-diene (4aS,7S,8aR)-4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene |
| Definitions |
The (4aS,7S,8aR)-stereoisomer of beta-selinene. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_49274 |
| charge |
0 |
| database_cross_reference |
Reaxys:4970262 Beilstein:4970262 Beilstein:3082013 |
| definition |
The (4aS,7S,8aR)-stereoisomer of beta-selinene. |
| formula |
C15H24 |
| has_exact_synonym |
(5beta,7alpha,10alpha)-eudesma-4(14),11-diene (4aS,7S,8aR)-4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(4aS,7S,8aR)-7-isopropenyl-4a-methyl-1-methylenedecahydronaphthalene |
| id |
CHEBI:49274 |
| in_subset | |
| inchi |
InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m0/s1 |
| inchikey |
YOVSPTNQHMDJAG-ZNMIVQPWSA-N |
| is enantiomer of | |
| label |
(-)-beta-selinene |
| mass |
204.35106 |
| monoisotopicmass |
204.18780 |
| notation |
CHEBI:49274 |
| prefLabel |
(-)-beta-selinene |
| smiles |
[H][C@@]1(CC[C@]2(C)CCCC(=C)[C@@]2([H])C1)C(C)=C |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C087920 | Medical Subject Headings / 医学主题词表 | LOOM |