Jump to:
loading...| Preferred Name |
3-methylcrotonyl glycine |
| Synonyms |
beta-Methylcrotonylglycine N-(3-methylbut-2-enoyl)glycine |
| Definitions |
An N-acylglycine in which the acyl group is specified as 3-methylbut-2-enoyl. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_68499 |
| charge |
0 |
| database_cross_reference |
PMID:22770225 CAS:33008-07-0 Reaxys:2079882 HMDB:HMDB0000459 |
| definition |
An N-acylglycine in which the acyl group is specified as 3-methylbut-2-enoyl. |
| formula |
C7H11NO3 |
| has functional parent | |
| has role | |
| has_exact_synonym |
N-(3-methylbut-2-enoyl)glycine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
beta-Methylcrotonylglycine |
| id |
CHEBI:68499 |
| in_subset | |
| inchi |
InChI=1S/C7H11NO3/c1-5(2)3-6(9)8-4-7(10)11/h3H,4H2,1-2H3,(H,8,9)(H,10,11) |
| inchikey |
PFWQSHXPNKRLIV-UHFFFAOYSA-N |
| label |
3-methylcrotonyl glycine |
| mass |
157.16710 |
| monoisotopicmass |
157.07389 |
| notation |
CHEBI:68499 |
| prefLabel |
3-methylcrotonyl glycine |
| smiles |
CC(C)=CC(=O)NCC(O)=O |
| treeView | |
| subClassOf |