loading...| Preferred Name |
lombricine |
| Synonyms |
O-[(2-carbamimidamidoethoxy)(hydroxy)phosphoryl]serine |
| Definitions |
A serine derivative that is serine in which the hydrogen of the hydroxy group has been replaced by a (2-carbamimidamidoethoxy)(hydroxy)phosphoryl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_25072 |
| charge |
0 |
| database_cross_reference |
PMID:22705027 PMID:1909513 Reaxys:1729503 PMID:13632801 PMID:14439305 |
| definition |
A serine derivative that is serine in which the hydrogen of the hydroxy group has been replaced by a (2-carbamimidamidoethoxy)(hydroxy)phosphoryl group. |
| formula |
C6H15N4O6P |
| has role | |
| has_exact_synonym |
O-[(2-carbamimidamidoethoxy)(hydroxy)phosphoryl]serine |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:25072 |
| in_subset | |
| inchi |
InChI=1S/C6H15N4O6P/c7-4(5(11)12)3-16-17(13,14)15-2-1-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H,13,14)(H4,8,9,10) |
| inchikey |
GSDBGCKBBJVPNC-UHFFFAOYSA-N |
| label |
lombricine |
| mass |
270.18030 |
| monoisotopicmass |
270.07292 |
| notation |
CHEBI:25072 |
| prefLabel |
lombricine |
| smiles |
NC(COP(O)(=O)OCCNC(N)=N)C(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_21968 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_21968 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C008295 | Medical Subject Headings / 医学主题词表 | LOOM |