loading...| Preferred Name |
lissamine fast yellow (acid form) |
| Synonyms |
lissamine fast yellow free acid 2,5-dichloro-4-{5-hydroxy-3-methyl-4-[(4-sulfophenyl)diazenyl]pyrazol-1-yl}benzene-1-sulfonic acid |
| Definitions |
An arenesulfonic acid that is 2,5-dichloro-4-(pyrazol-1-yl)benzene-1-sulfonic acid in which the pyrazole ring is substituted by methyl, (4-sulfophenyl)diazenyl and hydroxy groups at positions 3, 4, and 5 respctively. The disodium salt is the biological stain 'lissamine fast yellow'. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_90210 |
| charge |
0 |
| definition |
An arenesulfonic acid that is 2,5-dichloro-4-(pyrazol-1-yl)benzene-1-sulfonic acid in which the pyrazole ring is substituted by methyl, (4-sulfophenyl)diazenyl and hydroxy groups at positions 3, 4, and 5 respctively. The disodium salt is the biological stain 'lissamine fast yellow'. |
| formula |
C16H12Cl2N4O7S2 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_77182 |
| has_exact_synonym |
2,5-dichloro-4-{5-hydroxy-3-methyl-4-[(4-sulfophenyl)diazenyl]pyrazol-1-yl}benzene-1-sulfonic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
lissamine fast yellow free acid |
| id |
CHEBI:90210 |
| in_subset | |
| inchi |
InChI=1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,23H,1H3,(H,24,25,26)(H,27,28,29) |
| inchikey |
SWTAMHBAAIVEKW-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
lissamine fast yellow (acid form) |
| mass |
507.328 |
| monoisotopicmass |
505.95245 |
| notation |
CHEBI:90210 |
| prefLabel |
lissamine fast yellow (acid form) |
| smiles |
C1=C(C(=CC(=C1N2N=C(C(=C2O)N=NC=3C=CC(=CC3)S(O)(=O)=O)C)Cl)S(O)(=O)=O)Cl |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22682 http://purl.obolibrary.org/obo/CHEBI_74818 http://purl.obolibrary.org/obo/CHEBI_23697 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22682 http://purl.obolibrary.org/obo/CHEBI_74818 http://purl.obolibrary.org/obo/CHEBI_23697 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||