loading...| Preferred Name |
(S)-2-amino-6-boronohexanoic acid |
| Synonyms |
(2S)-2-amino-6-(dihydroxyboryl)hexanoic acid (2S)-2-amino-6-boronohexanoic acid 6-borono-L-norleucine 6-(dihydroxyboryl)-L-norleucine ABH 2(S)-AMINO-6-BORONOHEXANOIC ACID |
| Definitions |
L-Norleucine substituted at C-6 with a borono group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_40520 |
| charge |
0 |
| database_cross_reference |
Beilstein:8486411 DrugBank:DB01983 PMID:16141327 |
| definition |
L-Norleucine substituted at C-6 with a borono group. |
| formula |
C6H14BNO4 |
| has functional parent | |
| has_exact_synonym |
(2S)-2-amino-6-(dihydroxyboryl)hexanoic acid (2S)-2-amino-6-boronohexanoic acid 6-borono-L-norleucine 6-(dihydroxyboryl)-L-norleucine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
ABH 2(S)-AMINO-6-BORONOHEXANOIC ACID |
| id |
CHEBI:40520 |
| in_subset | |
| inchi |
InChI=1S/C6H14BNO4/c8-5(6(9)10)3-1-2-4-7(11)12/h5,11-12H,1-4,8H2,(H,9,10)/t5-/m0/s1 |
| inchikey |
HFKKMXCOJQIYAH-YFKPBYRVSA-N |
| is conjugate acid of | |
| label |
(S)-2-amino-6-boronohexanoic acid |
| mass |
174.99100 |
| monoisotopicmass |
175.10159 |
| notation |
CHEBI:40520 |
| prefLabel |
(S)-2-amino-6-boronohexanoic acid |
| smiles |
N[C@@H](CCCCB(O)O)C(O)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||