Jump to:
loading...| Preferred Name |
(-)-aristolochene |
| Synonyms |
(-)-aristolochene (1R,7R,8aS)-aristolochene Aristolochene (4R,4aS,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene 4betaH,5alpha-eremophila-9,11-diene |
| ID |
http://purl.obolibrary.org/obo/CHEBI_18027 |
| charge |
0 |
| database_cross_reference |
Beilstein:2249047 KEGG:C02004 Beilstein:3588802 CAS:26620-71-3 |
| formula |
C15H24 |
| has_alternative_id |
CHEBI:13855 CHEBI:2824 |
| has_exact_synonym |
(-)-aristolochene (4R,4aS,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene 4betaH,5alpha-eremophila-9,11-diene |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(1R,7R,8aS)-aristolochene Aristolochene |
| id |
CHEBI:18027 |
| in_subset | |
| inchi |
InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h9,12-13H,1,5-8,10H2,2-4H3/t12-,13-,15+/m1/s1 |
| inchikey |
YONHOSLUBQJXPR-NFAWXSAZSA-N |
| is enantiomer of | |
| label |
(-)-aristolochene |
| mass |
204.35106 |
| monoisotopicmass |
204.18780 |
| notation |
CHEBI:18027 |
| prefLabel |
(-)-aristolochene |
| smiles |
C[C@@H]1CCCC2=CC[C@H](C[C@@]12C)C(C)=C |
| treeView | |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C054277 | Medical Subject Headings / 医学主题词表 | LOOM |