loading...| Preferred Name |
2-carboxylato-D-arabinitol 1-phosphate(3-) |
| Synonyms |
2-carboxylato-D-arabinitol 1-phosphate trianion 2-C-[(phosphonooxy)methyl]-D-ribonate 2-carboxylato-D-arabinitol 1-phosphate 2-carboxy-D-arabinitol 1-phosphate |
| Definitions |
An organophosphate oxoanion that is a trianion resulting from the deprotonation of the carboxy and phosphate OH groups of 2-carboxy-D-arabinitol 1-phosphate; major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_58185 |
| charge |
-3 |
| definition |
An organophosphate oxoanion that is a trianion resulting from the deprotonation of the carboxy and phosphate OH groups of 2-carboxy-D-arabinitol 1-phosphate; major species at pH 7.3. |
| formula |
C6H10O10P |
| has_exact_synonym |
2-C-[(phosphonooxy)methyl]-D-ribonate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-carboxylato-D-arabinitol 1-phosphate trianion 2-carboxylato-D-arabinitol 1-phosphate 2-carboxy-D-arabinitol 1-phosphate |
| id |
CHEBI:58185 |
| in_subset | |
| inchi |
InChI=1S/C6H13O10P/c7-1-3(8)4(9)6(12,5(10)11)2-16-17(13,14)15/h3-4,7-9,12H,1-2H2,(H,10,11)(H2,13,14,15)/p-3/t3-,4-,6-/m1/s1 |
| inchikey |
UJTMIRNFEXKGMS-ZMIZWQJLSA-K |
| is conjugate base of | |
| label |
2-carboxylato-D-arabinitol 1-phosphate(3-) |
| mass |
273.11140 |
| monoisotopicmass |
273.00280 |
| notation |
CHEBI:58185 |
| prefLabel |
2-carboxylato-D-arabinitol 1-phosphate(3-) |
| smiles |
OC[C@@H](O)[C@@H](O)[C@](O)(COP([O-])([O-])=O)C([O-])=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_63551 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_63551 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||