| Preferred Name |
psychosine |
| Synonyms |
1-O-beta-D-galactopyranosylsphingosine Psychosine O-Galactosylsphingosine beta-psychosine O-galactosylsphingosine sphingosine galactoside (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-en-1-yl beta-D-galactopyranoside 1-beta-D-galactosylsphingosine Galactosylsphingosine 1-beta-D-galactosphingosine (2S,3R,4E)-2-amino-1-(beta-D-galactopyranosyloxy)-3-hydroxyoctadec-4-ene 1-O-beta-D-galactosylsphingosine |
| Definitions |
A glycosylsphingoid consisting of sphingosine having a beta-D-galactosyl residue attached at the 1-position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16874 |
| charge |
0 |
| database_cross_reference |
KEGG:C01747 CAS:2238-90-6 Wikipedia:Psychosine PMID:21259322 Beilstein:52571 Reaxys:52571 PMID:20209561 LIPID_MAPS_instance:LMSP07000001 PMID:29351991 HMDB:HMDB0000648 MetaCyc:PSYCHOSINE PMID:7542630 |
| definition |
A glycosylsphingoid consisting of sphingosine having a beta-D-galactosyl residue attached at the 1-position. |
| formula |
C24H47NO7 |
| has functional parent | |
| has role | |
| has_alternative_id |
CHEBI:8619 CHEBI:26370 CHEBI:14966 |
| has_exact_synonym |
Psychosine (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-en-1-yl beta-D-galactopyranoside |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
1-O-beta-D-galactopyranosylsphingosine O-Galactosylsphingosine beta-psychosine O-galactosylsphingosine sphingosine galactoside 1-beta-D-galactosylsphingosine Galactosylsphingosine 1-beta-D-galactosphingosine (2S,3R,4E)-2-amino-1-(beta-D-galactopyranosyloxy)-3-hydroxyoctadec-4-ene 1-O-beta-D-galactosylsphingosine |
| id |
CHEBI:16874 |
| in_subset | |
| inchi |
InChI=1S/C24H47NO7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(27)18(25)17-31-24-23(30)22(29)21(28)20(16-26)32-24/h14-15,18-24,26-30H,2-13,16-17,25H2,1H3/b15-14+/t18-,19+,20+,21-,22-,23+,24+/m0/s1 |
| inchikey |
HHJTWTPUPVQKNA-PIIMIWFASA-N |
| is conjugate base of | |
| label |
psychosine |
| mass |
461.63250 |
| monoisotopicmass |
461.33525 |
| notation |
CHEBI:16874 |
| prefLabel |
psychosine |
| smiles |
CCCCCCCCCCCCCC=C\[C@@H](O)[C@@H](N)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| treeView | |
| subClassOf |