loading...| Preferred Name |
N(6)-methyladenosine |
| Synonyms |
6-Methylaminopurine ribonucleoside N(6)-Methyladenosine 6-Methylaminopurine riboside 6-Methyladenosine N(6)-monomethyladenosine m6a 6-Methylaminopurinosine 6-Methylaminopurine D-riboside N-methyladenosine (2R,3S,4R,5R)-2-Hydroxymethyl-5-(6-methylamino-purin-9-yl)-tetrahydro-furan-3,4-diol |
| Definitions |
A methyladenosine compound with one methyl group attached to N(6) of the adenine nucleobase. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_21891 |
| charge |
0 |
| database_cross_reference |
PMID:28349455 LINCS:LSM-3835 PMID:27396363 PMID:26046440 Reaxys:42872 PMID:27467725 PMID:26323656 CAS:1867-73-8 PMID:26748145 Beilstein:42872 PMID:26958595 PMID:323854 |
| definition |
A methyladenosine compound with one methyl group attached to N(6) of the adenine nucleobase. |
| formula |
C11H15N5O4 |
| has_alternative_id |
CHEBI:424380 |
| has_exact_synonym |
N(6)-Methyladenosine N-methyladenosine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
6-Methylaminopurine ribonucleoside 6-Methylaminopurine riboside 6-Methyladenosine N(6)-monomethyladenosine m6a 6-Methylaminopurinosine 6-Methylaminopurine D-riboside (2R,3S,4R,5R)-2-Hydroxymethyl-5-(6-methylamino-purin-9-yl)-tetrahydro-furan-3,4-diol |
| id |
CHEBI:21891 |
| in_subset | |
| inchi |
InChI=1S/C11H15N5O4/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(19)7(18)5(2-17)20-11/h3-5,7-8,11,17-19H,2H2,1H3,(H,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| inchikey |
VQAYFKKCNSOZKM-IOSLPCCCSA-N |
| label |
N(6)-methyladenosine |
| mass |
281.26790 |
| monoisotopicmass |
281.11240 |
| notation |
CHEBI:21891 |
| prefLabel |
N(6)-methyladenosine |
| smiles |
CNc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/SO_0001297 | Sequence Types and Features Ontology / 序列类型和特征本体 | LOOM |