loading...| Preferred Name |
dUTP(4-) |
| Synonyms |
deoxy-UTP(4-) dUTP 2'-deoxyuridine-5'-triphosphate(4-) 2'-deoxyuridine-5'-triphosphate tetraanion 2'-deoxy-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)uridine 2'-deoxyuridine-5'-triphosphate dUTP tetraanion deoxyuridine-triphosphate(4-) |
| Definitions |
A 2'-deoxyribonucleoside 5'-triphosphate(4-) resulting from deprotonation of the triphosphate OH groups of 2'-deoxyuridine-5'-triphosphate (dUTP); major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_61555 |
| charge |
-4 |
| database_cross_reference |
MetaCyc:DUTP |
| definition |
A 2'-deoxyribonucleoside 5'-triphosphate(4-) resulting from deprotonation of the triphosphate OH groups of 2'-deoxyuridine-5'-triphosphate (dUTP); major species at pH 7.3. |
| formula |
C9H11N2O14P3 |
| has_exact_synonym |
2'-deoxy-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)uridine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
deoxy-UTP(4-) dUTP 2'-deoxyuridine-5'-triphosphate(4-) 2'-deoxyuridine-5'-triphosphate tetraanion 2'-deoxyuridine-5'-triphosphate dUTP tetraanion deoxyuridine-triphosphate(4-) |
| id |
CHEBI:61555 |
| in_subset | |
| inchi |
InChI=1S/C9H15N2O14P3/c12-5-3-8(11-2-1-7(13)10-9(11)14)23-6(5)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,20,21)(H,10,13,14)(H2,15,16,17)/p-4/t5-,6+,8+/m0/s1 |
| inchikey |
AHCYMLUZIRLXAA-SHYZEUOFSA-J |
| is conjugate base of | |
| label |
dUTP(4-) |
| mass |
464.10990 |
| monoisotopicmass |
463.94451 |
| notation |
CHEBI:61555 |
| prefLabel |
dUTP(4-) |
| smiles |
O[C@H]1C[C@@H](O[C@@H]1COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)n1ccc(=O)[nH]c1=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/OGG_3100873910 | Ontology of Genes and Genomes / 基因和基因组本体 | LOOM |