loading...| Preferred Name |
(aminooxy)acetic acid |
| Synonyms |
(O-carboxymethyl)hydroxylamine carboxymethoxyamine aminooxyacetic acid AOA (carboxymethoxy)amine U-7524 2-aminooxyethanoic acid AOAA 2-(aminooxy)acetic acid (aminooxy)acetic acid |
| Definitions |
A member of the class of hydroxylamines that is acetic acid substituted at postion 2 by an aminooxy group. It is a compound which inhibits aminobutyrate aminotransferase activity in vivo, resulting in increased levels of gamma-aminobutyric acid in tissues. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_40823 |
| charge |
0 |
| database_cross_reference |
PMID:31410589 PMID:31930778 PMID:32072910 PMID:27157912 PMID:12234190 PMID:27257787 PMID:18687801 Reaxys:878238 PMID:28533892 PMID:31032581 PMID:27639598 PMID:22128428 MetaCyc:CARBOXYMETHOXYLAMINE Wikipedia:Aminooxyacetic_acid PMID:20208150 PMID:30127117 PMID:12899834 PMID:8930249 CAS:645-88-5 PMID:15791207 PMID:25462081 Chemspider:280 PDBeChem:AOA DrugBank:DB02079 PMID:3251251 PMID:32194794 PMID:15480681 PMID:31912705 |
| definition |
A member of the class of hydroxylamines that is acetic acid substituted at postion 2 by an aminooxy group. It is a compound which inhibits aminobutyrate aminotransferase activity in vivo, resulting in increased levels of gamma-aminobutyric acid in tissues. |
| formula |
C2H5NO3 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_63157 http://purl.obolibrary.org/obo/CHEBI_35623 |
| has_exact_synonym |
(aminooxy)acetic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(O-carboxymethyl)hydroxylamine carboxymethoxyamine aminooxyacetic acid AOA (carboxymethoxy)amine U-7524 2-aminooxyethanoic acid AOAA 2-(aminooxy)acetic acid |
| id |
CHEBI:40823 |
| in_subset | |
| inchi |
InChI=1S/C2H5NO3/c3-6-1-2(4)5/h1,3H2,(H,4,5) |
| inchikey |
NQRKYASMKDDGHT-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
(aminooxy)acetic acid |
| mass |
91.066 |
| monoisotopicmass |
91.02694 |
| notation |
CHEBI:40823 |
| prefLabel |
(aminooxy)acetic acid |
| smiles |
NOCC(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_25384 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25384 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/D000625 | Medical Subject Headings / 医学主题词表 | LOOM |