loading...| Preferred Name |
pitavastatin calcium |
| Synonyms |
Bis((3R,5S,6E)-7-(2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl)-3,5-dihydroxy-6-heptenoate) monocalcium salt Pitavastatin hemicalcium calcium bis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate} |
| Definitions |
The calcium salt of pitavastatin. Used for treatment of hypercholesterolemia (elevated levels of cholesterol in the blood) on patients unable to sufficiently lower their cholesterol levels by diet and exercise. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_71258 |
| charge |
0 |
| database_cross_reference |
PMID:21069103 Patent:WO2012002741 PMID:21816477 Patent:KR20110092804 Patent:KR20110097058 Patent:US2012016129 Wikipedia:Pitavastatin Patent:WO2007132482 KEGG:D01862 Patent:WO2005063711 Patent:US2011082298 Patent:US2009182008 PMID:20852754 Patent:US2011319624 PMID:21381428 CAS:147526-32-7 Reaxys:7965530 PMID:20621877 PMID:20664824 PMID:21225019 Patent:WO2011105649 Patent:WO2012025939 PMID:21651447 Patent:EP2383260 Patent:WO2007125547 Patent:US2012101126 |
| definition |
The calcium salt of pitavastatin. Used for treatment of hypercholesterolemia (elevated levels of cholesterol in the blood) on patients unable to sufficiently lower their cholesterol levels by diet and exercise. |
| formula |
C50H46CaF2N2O8 |
| has part | |
| has role | |
| has_exact_synonym |
calcium bis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate} |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Bis((3R,5S,6E)-7-(2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl)-3,5-dihydroxy-6-heptenoate) monocalcium salt Pitavastatin hemicalcium |
| id |
CHEBI:71258 |
| in_subset | |
| inchi |
InChI=1S/2C25H24FNO4.Ca/c2*26-17-9-7-15(8-10-17)24-20-3-1-2-4-22(20)27-25(16-5-6-16)21(24)12-11-18(28)13-19(29)14-23(30)31;/h2*1-4,7-12,16,18-19,28-29H,5-6,13-14H2,(H,30,31);/q;;+2/p-2/b2*12-11+;/t2*18-,19-;/m11./s1 |
| inchikey |
RHGYHLPFVJEAOC-FFNUKLMVSA-L |
| label |
pitavastatin calcium |
| mass |
880.98400 |
| monoisotopicmass |
880.28481 |
| notation |
CHEBI:71258 |
| prefLabel |
pitavastatin calcium |
| smiles |
[Ca++].O[C@H](C[C@H](O)C=C\c1c(nc2ccccc2c1-c1ccc(F)cc1)C1CC1)CC([O-])=O.O[C@H](C[C@H](O)\C=C\c1c(nc2ccccc2c1-c1ccc(F)cc1)C1CC1)CC([O-])=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C87752 | National Cancer Institute Thesaurus / 美国国家癌症研究所词典 | LOOM |