| Preferred Name |
ribitol |
| Synonyms |
meso-ribitol Adonitol D-Ribitol (2R,3s,4S)-pentane-1,2,3,4,5-pentol Ribitol ribitol L-ribitol D-Adonitol |
| Definitions |
A pentitol (five-carbon sugar alcohol) having meso-configuration, being derived from ribose by reduction of the carbonyl group. It occurs naturally in the plant Adonis vernalis. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_15963 |
| charge |
0 |
| database_cross_reference |
MetaCyc:RIBITOL CAS:488-81-3 Wikipedia:Ribitol PMID:17336832 Reaxys:1720524 HMDB:HMDB0000508 PMID:23564164 Beilstein:1720524 KEGG:C00474 PMID:16664320 PMID:25108762 PMID:15234337 PMID:17979222 PMID:16901854 Gmelin:82894 PMID:24643482 KNApSAcK:C00001171 |
| definition |
A pentitol (five-carbon sugar alcohol) having meso-configuration, being derived from ribose by reduction of the carbonyl group. It occurs naturally in the plant Adonis vernalis. |
| formula |
C5H12O5 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_83056 |
| has_alternative_id |
CHEBI:21074 CHEBI:8841 CHEBI:4230 CHEBI:27854 CHEBI:57591 CHEBI:26552 CHEBI:48505 CHEBI:15043 |
| has_exact_synonym |
meso-ribitol (2R,3s,4S)-pentane-1,2,3,4,5-pentol Ribitol ribitol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Adonitol D-Ribitol (2R,3s,4S)-pentane-1,2,3,4,5-pentol L-ribitol D-Adonitol |
| id |
CHEBI:15963 |
| in_subset | |
| inchi |
InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| inchikey |
HEBKCHPVOIAQTA-ZXFHETKHSA-N |
| label |
ribitol |
| mass |
152.14578 |
| monoisotopicmass |
152.06847 |
| notation |
CHEBI:15963 |
| prefLabel |
ribitol |
| smiles |
OC[C@H](O)[C@H](O)[C@H](O)CO |
| treeView | |
| subClassOf |