loading...| Preferred Name |
3'-L-tyrosyl-AMP |
| Synonyms |
3'-O-L-tyrosyladenosine 5'-(dihydrogen phosphate) 3'-O-L-tyrosyladenosine 5'-monophosphate 3'-tyrosyl-AMP 3'-O-L-tyrosyl-AMP 3'-O-tyrosyl-AMP |
| Definitions |
An L-tyrosyl ester obtained by formal condensation of the carboxy group of L-tyrosine with the 3'-hydroxy group of AMP. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_131576 |
| charge |
0 |
| definition |
An L-tyrosyl ester obtained by formal condensation of the carboxy group of L-tyrosine with the 3'-hydroxy group of AMP. |
| formula |
C19H23N6O9P |
| has functional parent | |
| has role | |
| has_obo_namespace |
chebi_ontology |
| hasExactSynonym |
3'-O-L-tyrosyladenosine 5'-(dihydrogen phosphate) |
| hasRelatedSynonym |
3'-O-L-tyrosyladenosine 5'-monophosphate 3'-tyrosyl-AMP 3'-O-L-tyrosyl-AMP 3'-O-tyrosyl-AMP |
| id |
CHEBI:131576 |
| in_subset | |
| inchi |
InChI=1S/C19H23N6O9P/c20-11(5-9-1-3-10(26)4-2-9)19(28)34-15-12(6-32-35(29,30)31)33-18(14(15)27)25-8-24-13-16(21)22-7-23-17(13)25/h1-4,7-8,11-12,14-15,18,26-27H,5-6,20H2,(H2,21,22,23)(H2,29,30,31)/t11-,12+,14+,15+,18+/m0/s1 |
| inchikey |
IEDNIXUXZOSRER-URQYDQELSA-N |
| label |
3'-L-tyrosyl-AMP |
| mass |
510.395 |
| monoisotopicmass |
510.12641 |
| notation |
CHEBI:131576 |
| prefLabel |
3'-L-tyrosyl-AMP |
| smiles |
NC1=NC=NC2=C1N=CN2[C@@H]3O[C@H](COP(=O)(O)O)[C@@H](OC(=O)[C@@H](N)CC=4C=CC(=CC4)O)[C@H]3O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_21415 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_21415 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||