loading...| Preferred Name |
mollicellin N |
| Synonyms |
8,13-dihydroxy-2,2,5,10-tetramethyl-4,11-dioxo-3,4-dihydro-2H,11H-chromeno[6,7-b][1,4]benzodioxepine-7-carbaldehyde |
| Definitions |
A member of the class of depsidones that is 3,4-dihydro-2H,11H-chromeno[6,7-b][1,4]benzodioxepine substituted by hydroxy groups at positions 8 and 13, methyl groups at positions 2, 2, 5 and 10, oxo groups at positions 4 and 11 and a formyl group at position 7. Isolated from Chaetomium brasiliense, it exhibits cytotoxic activity. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_68727 |
| charge |
0 |
| database_cross_reference |
Chemspider:24674002 PMID:19663417 Reaxys:19895969 |
| definition |
A member of the class of depsidones that is 3,4-dihydro-2H,11H-chromeno[6,7-b][1,4]benzodioxepine substituted by hydroxy groups at positions 8 and 13, methyl groups at positions 2, 2, 5 and 10, oxo groups at positions 4 and 11 and a formyl group at position 7. Isolated from Chaetomium brasiliense, it exhibits cytotoxic activity. |
| formula |
C21H18O8 |
| has role | |
| has_exact_synonym |
8,13-dihydroxy-2,2,5,10-tetramethyl-4,11-dioxo-3,4-dihydro-2H,11H-chromeno[6,7-b][1,4]benzodioxepine-7-carbaldehyde |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:68727 |
| in_subset | |
| inchi |
InChI=1S/C21H18O8/c1-8-5-11(23)10(7-22)17-13(8)20(26)28-19-15(25)18-14(9(2)16(19)27-17)12(24)6-21(3,4)29-18/h5,7,23,25H,6H2,1-4H3 |
| inchikey |
FMZRBSGCMFABIX-UHFFFAOYSA-N |
| label |
mollicellin N |
| mass |
398.36280 |
| monoisotopicmass |
398.10017 |
| notation |
CHEBI:68727 |
| prefLabel |
mollicellin N |
| smiles |
Cc1cc(O)c(C=O)c2Oc3c(C)c4C(=O)CC(C)(C)Oc4c(O)c3OC(=O)c12 |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_75939 http://purl.obolibrary.org/obo/CHEBI_38163 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_75939 http://purl.obolibrary.org/obo/CHEBI_38163 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||