loading...| Preferred Name |
monobromobimane |
| Synonyms |
MBBR Bimane monobromide Bromobimane 3-(bromomethyl)-2,5,6-trimethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione |
| Definitions |
A pyrazolopyrazole that consists of 1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione bearing three methyl substituents at positions 2, 5 and 6 as well as a bromomethyl substituent at the 3-position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_62825 |
| charge |
0 |
| database_cross_reference |
PMID:21780308 PMID:15013008 PMID:21228815 PMID:15056859 PMID:3544950 PMID:21815068 PMID:21276849 PMID:21126841 CAS:71418-44-5 Wikipedia:Bromobimane Reaxys:4186557 PMID:21561813 MetaCyc:CPD1G-159 |
| definition |
A pyrazolopyrazole that consists of 1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione bearing three methyl substituents at positions 2, 5 and 6 as well as a bromomethyl substituent at the 3-position. |
| formula |
C10H11BrN2O2 |
| has role | |
| has_exact_synonym |
3-(bromomethyl)-2,5,6-trimethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
MBBR Bimane monobromide Bromobimane |
| id |
CHEBI:62825 |
| in_subset | |
| inchi |
InChI=1S/C10H11BrN2O2/c1-5-7(3)12-8(4-11)6(2)10(15)13(12)9(5)14/h4H2,1-3H3 |
| inchikey |
AHEWZZJEDQVLOP-UHFFFAOYSA-N |
| label |
monobromobimane |
| mass |
271.11100 |
| monoisotopicmass |
270.00039 |
| notation |
CHEBI:62825 |
| prefLabel |
monobromobimane |
| smiles |
Cc1c(C)c(=O)n2n1c(CBr)c(C)c2=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C028381 | Medical Subject Headings / 医学主题词表 | LOOM |